C13H19NO — CID 70917166
4-(5-methylcyclohepta-1,3,6-trien-1-yl)oxypiperidine (PubChem CID 70917166) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-(5-methylcyclohepta-1,3,6-trien-1-yl)oxypiperidine.
| Compound Name | 4-(5-methylcyclohepta-1,3,6-trien-1-yl)oxypiperidine |
|---|---|
| PubChem CID | 70917166 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-(5-methylcyclohepta-1,3,6-trien-1-yl)oxypiperidine |
| SMILES | CC1C=CC=C(OC2CCNCC2)C=C1 |
| InChI | InChI=1S/C13H19NO/c1-11-3-2-4-12(6-5-11)15-13-7-9-14-10-8-13/h2-6,11,13-14H,7-10H2,1H3 |
| InChIKey | AIWPODQMHNOKMS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |