C12H19NO — CID 89211368
4-[(3Z,5E)-hepta-1,3,5-trien-2-yl]oxypiperidine (PubChem CID 89211368) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-[(3Z,5E)-hepta-1,3,5-trien-2-yl]oxypiperidine.
| Compound Name | 4-[(3Z,5E)-hepta-1,3,5-trien-2-yl]oxypiperidine |
|---|---|
| PubChem CID | 89211368 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-[(3Z,5E)-hepta-1,3,5-trien-2-yl]oxypiperidine |
| SMILES | C=C(/C=C\C=C\C)OC1CCNCC1 |
| InChI | InChI=1S/C12H19NO/c1-3-4-5-6-11(2)14-12-7-9-13-10-8-12/h3-6,12-13H,2,7-10H2,1H3/b4-3+,6-5- |
| InChIKey | GCLSYIAAWAEXMP-ICWBMWKASA-N |
| XLogP | 2.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|