About N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine
N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine (PubChem CID 138714787) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine.
Molecular Properties
| Compound Name | N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine |
| PubChem CID | 138714787 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine |
| SMILES | CNC1CCC2=CC=C=CC=C2O1 |
| InChI | InChI=1S/C11H13NO/c1-12-11-8-7-9-5-3-2-4-6-10(9)13-11/h3-6,11-12H,7-8H2,1H3 |
| InChIKey | BEIJFTWRAQORIN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine?
The IUPAC name of N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine (CID 138714787) is N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine.
What is the SMILES notation for N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine?
The canonical SMILES for N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine is CNC1CCC2=CC=C=CC=C2O1.
What is the InChIKey of N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine?
The InChIKey is BEIJFTWRAQORIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-12-11-8-7-9-5-3-2-4-6-10(9)13-11/h3-6,11-12H,7-8H2,1H3.
What are the key properties of N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine?
N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine has a molecular weight of 175.23 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-2-amine is sourced from PubChem (CID 138714787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).