C15H21N — CID 115896468
N-(1-cyclobutylethyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 115896468) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(1-cyclobutylethyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(1-cyclobutylethyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 115896468 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-(1-cyclobutylethyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | CC(NC1Cc2ccccc2C1)C1CCC1 |
| InChI | InChI=1S/C15H21N/c1-11(12-7-4-8-12)16-15-9-13-5-2-3-6-14(13)10-15/h2-3,5-6,11-12,15-16H,4,7-10H2,1H3 |
| InChIKey | SXOOSHJOCYMERY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |