About N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine
N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 115721294) has the molecular formula C14H19NS
and a molecular weight of 233.38 g/mol. Its IUPAC name is N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine.
Molecular Properties
| Compound Name | N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine |
| PubChem CID | 115721294 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CC(NC1CSc2ccccc21)C1CCC1 |
| InChI | InChI=1S/C14H19NS/c1-10(11-5-4-6-11)15-13-9-16-14-8-3-2-7-12(13)14/h2-3,7-8,10-11,13,15H,4-6,9H2,1H3 |
| InChIKey | KIZADAJQYZELIV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine?
The IUPAC name of N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine (CID 115721294) is N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine.
What is the SMILES notation for N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine?
The canonical SMILES for N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine is CC(NC1CSc2ccccc21)C1CCC1.
What is the InChIKey of N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine?
The InChIKey is KIZADAJQYZELIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NS/c1-10(11-5-4-6-11)15-13-9-16-14-8-3-2-7-12(13)14/h2-3,7-8,10-11,13,15H,4-6,9H2,1H3.
What are the key properties of N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine?
N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine has a molecular weight of 233.38 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclobutylethyl)-2,3-dihydro-1-benzothiophen-3-amine is sourced from PubChem (CID 115721294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).