C16H23NOS — CID 103777436
N-[1-(oxan-4-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 103777436) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is N-[1-(oxan-4-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-[1-(oxan-4-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 103777436 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[1-(oxan-4-yl)ethyl]-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CC(NC1CCSc2ccccc21)C1CCOCC1 |
| InChI | InChI=1S/C16H23NOS/c1-12(13-6-9-18-10-7-13)17-15-8-11-19-16-5-3-2-4-14(15)16/h2-5,12-13,15,17H,6-11H2,1H3 |
| InChIKey | RXVWGPSFBPTZIQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |