C18H27NS — CID 63476797
N-(1-cyclohexylpropyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 63476797) has the molecular formula C18H27NS and a molecular weight of 289.49 g/mol. Its IUPAC name is N-(1-cyclohexylpropyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-(1-cyclohexylpropyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 63476797 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-(1-cyclohexylpropyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCC(NC1CCSc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C18H27NS/c1-2-16(14-8-4-3-5-9-14)19-17-12-13-20-18-11-7-6-10-15(17)18/h6-7,10-11,14,16-17,19H,2-5,8-9,12-13H2,1H3 |
| InChIKey | NEKCVQQXPVIFMX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |