C19H23NS — CID 79008955
N-(1-phenylbutan-2-yl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 79008955) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is N-(1-phenylbutan-2-yl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-(1-phenylbutan-2-yl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 79008955 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-(1-phenylbutan-2-yl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCC(Cc1ccccc1)NC1CCSc2ccccc21 |
| InChI | InChI=1S/C19H23NS/c1-2-16(14-15-8-4-3-5-9-15)20-18-12-13-21-19-11-7-6-10-17(18)19/h3-11,16,18,20H,2,12-14H2,1H3 |
| InChIKey | KOYIGYALGUSYAM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |