About N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine
N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 81300725) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine.
Molecular Properties
| Compound Name | N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine |
| PubChem CID | 81300725 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CC(C)C(C)NC1CSc2ccccc21 |
| InChI | InChI=1S/C13H19NS/c1-9(2)10(3)14-12-8-15-13-7-5-4-6-11(12)13/h4-7,9-10,12,14H,8H2,1-3H3 |
| InChIKey | NBJFHYSGAAKPCC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine?
The IUPAC name of N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine (CID 81300725) is N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine.
What is the SMILES notation for N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine?
The canonical SMILES for N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine is CC(C)C(C)NC1CSc2ccccc21.
What is the InChIKey of N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine?
The InChIKey is NBJFHYSGAAKPCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NS/c1-9(2)10(3)14-12-8-15-13-7-5-4-6-11(12)13/h4-7,9-10,12,14H,8H2,1-3H3.
What are the key properties of N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine?
N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine has a molecular weight of 221.37 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylbutan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine is sourced from PubChem (CID 81300725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).