About 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide
3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide (PubChem CID 115898575) has the molecular formula C14H19N3O2S2
and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide |
| PubChem CID | 115898575 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide |
| SMILES | Cc1cnc(C(C)NC(C)c2cccc(S(N)(=O)=O)c2)s1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-9-8-16-14(20-9)11(3)17-10(2)12-5-4-6-13(7-12)21(15,18)19/h4-8,10-11,17H,1-3H3,(H2,15,18,19) |
| InChIKey | XHZWYIMYQRAJPR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide?
The IUPAC name of 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide (CID 115898575) is 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide.
What is the SMILES notation for 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide?
The canonical SMILES for 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide is Cc1cnc(C(C)NC(C)c2cccc(S(N)(=O)=O)c2)s1.
What is the InChIKey of 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide?
The InChIKey is XHZWYIMYQRAJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2S2/c1-9-8-16-14(20-9)11(3)17-10(2)12-5-4-6-13(7-12)21(15,18)19/h4-8,10-11,17H,1-3H3,(H2,15,18,19).
What are the key properties of 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide?
3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide has a molecular weight of 325.46 g/mol, XLogP of 2.51, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide is sourced from PubChem (CID 115898575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).