C12H19NO4 — CID 115902257
3-(furan-2-yl)-N-(2-hydroxyethyl)-N-(2-methoxyethyl)propanamide (PubChem CID 115902257) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(2-hydroxyethyl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(furan-2-yl)-N-(2-hydroxyethyl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 115902257 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-(furan-2-yl)-N-(2-hydroxyethyl)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCN(CCO)C(=O)CCc1ccco1 |
| InChI | InChI=1S/C12H19NO4/c1-16-10-7-13(6-8-14)12(15)5-4-11-3-2-9-17-11/h2-3,9,14H,4-8,10H2,1H3 |
| InChIKey | AGJQIZRMMFYSOE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |