C17H20BrNO3S — CID 60567081
3-(4-bromophenyl)sulfanyl-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)propanamide (PubChem CID 60567081) has the molecular formula C17H20BrNO3S and a molecular weight of 398.32 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfanyl-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(4-bromophenyl)sulfanyl-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 60567081 |
| Molecular Formula | C17H20BrNO3S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 3-(4-bromophenyl)sulfanyl-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCN(Cc1ccco1)C(=O)CCSc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H20BrNO3S/c1-21-11-9-19(13-15-3-2-10-22-15)17(20)8-12-23-16-6-4-14(18)5-7-16/h2-7,10H,8-9,11-13H2,1H3 |
| InChIKey | QLBHRQFHFNDLJR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |