C11H12F3NO3S — CID 115903044
2,3,4-trifluoro-N-[1-(hydroxymethyl)cyclobutyl]benzenesulfonamide (PubChem CID 115903044) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[1-(hydroxymethyl)cyclobutyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[1-(hydroxymethyl)cyclobutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 115903044 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2,3,4-trifluoro-N-[1-(hydroxymethyl)cyclobutyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1(CO)CCC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H12F3NO3S/c12-7-2-3-8(10(14)9(7)13)19(17,18)15-11(6-16)4-1-5-11/h2-3,15-16H,1,4-6H2 |
| InChIKey | WGEQVUVGYLFSQM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|