C17H16F3NO2S — CID 51111664
2,3,4-trifluoro-N-[(1-phenylcyclobutyl)methyl]benzenesulfonamide (PubChem CID 51111664) has the molecular formula C17H16F3NO2S and a molecular weight of 355.38 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(1-phenylcyclobutyl)methyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[(1-phenylcyclobutyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51111664 |
| Molecular Formula | C17H16F3NO2S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2,3,4-trifluoro-N-[(1-phenylcyclobutyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(c2ccccc2)CCC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H16F3NO2S/c18-13-7-8-14(16(20)15(13)19)24(22,23)21-11-17(9-4-10-17)12-5-2-1-3-6-12/h1-3,5-8,21H,4,9-11H2 |
| InChIKey | VBRQLUSIZHGOFP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|