C11H22FN3O — CID 115903706
N-ethyl-4-(3-fluoropropylamino)piperidine-1-carboxamide (PubChem CID 115903706) has the molecular formula C11H22FN3O and a molecular weight of 231.31 g/mol. Its IUPAC name is N-ethyl-4-(3-fluoropropylamino)piperidine-1-carboxamide.
| Compound Name | N-ethyl-4-(3-fluoropropylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 115903706 |
| Molecular Formula | C11H22FN3O |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-ethyl-4-(3-fluoropropylamino)piperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC(NCCCF)CC1 |
| InChI | InChI=1S/C11H22FN3O/c1-2-13-11(16)15-8-4-10(5-9-15)14-7-3-6-12/h10,14H,2-9H2,1H3,(H,13,16) |
| InChIKey | SZPWKXUORLYFOC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|