C13H28N4O3S — CID 131925200
N-ethyl-4-[1-(ethylsulfonylamino)propan-2-ylamino]piperidine-1-carboxamide (PubChem CID 131925200) has the molecular formula C13H28N4O3S and a molecular weight of 320.46 g/mol. Its IUPAC name is N-ethyl-4-[1-(ethylsulfonylamino)propan-2-ylamino]piperidine-1-carboxamide.
| Compound Name | N-ethyl-4-[1-(ethylsulfonylamino)propan-2-ylamino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 131925200 |
| Molecular Formula | C13H28N4O3S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-ethyl-4-[1-(ethylsulfonylamino)propan-2-ylamino]piperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC(NC(C)CNS(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C13H28N4O3S/c1-4-14-13(18)17-8-6-12(7-9-17)16-11(3)10-15-21(19,20)5-2/h11-12,15-16H,4-10H2,1-3H3,(H,14,18) |
| InChIKey | LQMFEDZACVAKSN-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |