C11H24N2O4S2 — CID 131900362
N-[2-[(1,1-dioxothian-4-yl)amino]propyl]propane-1-sulfonamide (PubChem CID 131900362) has the molecular formula C11H24N2O4S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is N-[2-[(1,1-dioxothian-4-yl)amino]propyl]propane-1-sulfonamide.
| Compound Name | N-[2-[(1,1-dioxothian-4-yl)amino]propyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 131900362 |
| Molecular Formula | C11H24N2O4S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-[2-[(1,1-dioxothian-4-yl)amino]propyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCC(C)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H24N2O4S2/c1-3-6-19(16,17)12-9-10(2)13-11-4-7-18(14,15)8-5-11/h10-13H,3-9H2,1-2H3 |
| InChIKey | VIRIHMDNYUBCEV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |