C6H12BrNO4S2 — CID 83084232
1-bromo-N-(1,1-dioxothian-4-yl)methanesulfonamide (PubChem CID 83084232) has the molecular formula C6H12BrNO4S2 and a molecular weight of 306.20 g/mol. Its IUPAC name is 1-bromo-N-(1,1-dioxothian-4-yl)methanesulfonamide.
| Compound Name | 1-bromo-N-(1,1-dioxothian-4-yl)methanesulfonamide |
|---|---|
| PubChem CID | 83084232 |
| Molecular Formula | C6H12BrNO4S2 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | 1-bromo-N-(1,1-dioxothian-4-yl)methanesulfonamide |
| SMILES | O=S1(=O)CCC(NS(=O)(=O)CBr)CC1 |
| InChI | InChI=1S/C6H12BrNO4S2/c7-5-14(11,12)8-6-1-3-13(9,10)4-2-6/h6,8H,1-5H2 |
| InChIKey | XCSBBWSNBRBDFD-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|