C12H18N2S2 — CID 115903739
5-[1-(1-methylsulfanylbutan-2-ylamino)ethyl]thiophene-2-carbonitrile (PubChem CID 115903739) has the molecular formula C12H18N2S2 and a molecular weight of 254.42 g/mol. Its IUPAC name is 5-[1-(1-methylsulfanylbutan-2-ylamino)ethyl]thiophene-2-carbonitrile.
| Compound Name | 5-[1-(1-methylsulfanylbutan-2-ylamino)ethyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 115903739 |
| Molecular Formula | C12H18N2S2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-[1-(1-methylsulfanylbutan-2-ylamino)ethyl]thiophene-2-carbonitrile |
| SMILES | CCC(CSC)NC(C)c1ccc(C#N)s1 |
| InChI | InChI=1S/C12H18N2S2/c1-4-10(8-15-3)14-9(2)12-6-5-11(7-13)16-12/h5-6,9-10,14H,4,8H2,1-3H3 |
| InChIKey | PFUMRSZIVTYXAR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |