C13H25NOS — CID 115905849
7,7-dimethyl-N-(4-methylsulfanylbutyl)-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 115905849) has the molecular formula C13H25NOS and a molecular weight of 243.42 g/mol. Its IUPAC name is 7,7-dimethyl-N-(4-methylsulfanylbutyl)-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | 7,7-dimethyl-N-(4-methylsulfanylbutyl)-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 115905849 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 7,7-dimethyl-N-(4-methylsulfanylbutyl)-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | CSCCCCNC1C2CCOC2C1(C)C |
| InChI | InChI=1S/C13H25NOS/c1-13(2)11(10-6-8-15-12(10)13)14-7-4-5-9-16-3/h10-12,14H,4-9H2,1-3H3 |
| InChIKey | CJSIUZPRHXVCFA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|