C12H23NOS — CID 64863345
7,7-dimethyl-N-(3-methylsulfanylpropyl)-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 64863345) has the molecular formula C12H23NOS and a molecular weight of 229.39 g/mol. Its IUPAC name is 7,7-dimethyl-N-(3-methylsulfanylpropyl)-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | 7,7-dimethyl-N-(3-methylsulfanylpropyl)-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 64863345 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 7,7-dimethyl-N-(3-methylsulfanylpropyl)-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | CSCCCNC1C2CCOC2C1(C)C |
| InChI | InChI=1S/C12H23NOS/c1-12(2)10(13-6-4-8-15-3)9-5-7-14-11(9)12/h9-11,13H,4-8H2,1-3H3 |
| InChIKey | QNCQFPSWIUGGPK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|