C10H13N3O2S — CID 115907720
1-(5-methylfuran-2-yl)-2-(thiadiazol-4-ylmethylamino)ethanol (PubChem CID 115907720) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-(5-methylfuran-2-yl)-2-(thiadiazol-4-ylmethylamino)ethanol.
| Compound Name | 1-(5-methylfuran-2-yl)-2-(thiadiazol-4-ylmethylamino)ethanol |
|---|---|
| PubChem CID | 115907720 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-(5-methylfuran-2-yl)-2-(thiadiazol-4-ylmethylamino)ethanol |
| SMILES | Cc1ccc(C(O)CNCc2csnn2)o1 |
| InChI | InChI=1S/C10H13N3O2S/c1-7-2-3-10(15-7)9(14)5-11-4-8-6-16-13-12-8/h2-3,6,9,11,14H,4-5H2,1H3 |
| InChIKey | IMZYMEMRVHQLDX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |