C5H7F2N3S — CID 115405649
2,2-difluoro-N-(thiadiazol-4-ylmethyl)ethanamine (PubChem CID 115405649) has the molecular formula C5H7F2N3S and a molecular weight of 179.20 g/mol. Its IUPAC name is 2,2-difluoro-N-(thiadiazol-4-ylmethyl)ethanamine.
| Compound Name | 2,2-difluoro-N-(thiadiazol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115405649 |
| Molecular Formula | C5H7F2N3S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 2,2-difluoro-N-(thiadiazol-4-ylmethyl)ethanamine |
| SMILES | FC(F)CNCc1csnn1 |
| InChI | InChI=1S/C5H7F2N3S/c6-5(7)2-8-1-4-3-11-10-9-4/h3,5,8H,1-2H2 |
| InChIKey | GUMMWQJFAXMLMH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |