C10H20FNO — CID 115908276
N-(3-fluoropropyl)-2,6-dimethyloxan-4-amine (PubChem CID 115908276) has the molecular formula C10H20FNO and a molecular weight of 189.27 g/mol. Its IUPAC name is N-(3-fluoropropyl)-2,6-dimethyloxan-4-amine.
| Compound Name | N-(3-fluoropropyl)-2,6-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 115908276 |
| Molecular Formula | C10H20FNO |
| Molecular Weight | 189.27 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-(3-fluoropropyl)-2,6-dimethyloxan-4-amine |
| SMILES | CC1CC(NCCCF)CC(C)O1 |
| InChI | InChI=1S/C10H20FNO/c1-8-6-10(7-9(2)13-8)12-5-3-4-11/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | FJDGCFAHJZGFQZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|