C10H14N2O4 — CID 115909849
3-methyl-3-(1,2-oxazole-3-carbonylamino)pentanoic acid (PubChem CID 115909849) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-methyl-3-(1,2-oxazole-3-carbonylamino)pentanoic acid.
| Compound Name | 3-methyl-3-(1,2-oxazole-3-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 115909849 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-methyl-3-(1,2-oxazole-3-carbonylamino)pentanoic acid |
| SMILES | CCC(C)(CC(=O)O)NC(=O)c1ccon1 |
| InChI | InChI=1S/C10H14N2O4/c1-3-10(2,6-8(13)14)11-9(15)7-4-5-16-12-7/h4-5H,3,6H2,1-2H3,(H,11,15)(H,13,14) |
| InChIKey | COIQTEYMTOXXDZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |