C12H14N2O4 — CID 115910151
1-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]cyclobutane-1-carboxylic acid (PubChem CID 115910151) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 1-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115910151 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]cyclobutane-1-carboxylic acid |
| SMILES | Cc1ccc(C(=O)NC2(C(=O)O)CCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H14N2O4/c1-7-3-4-8(9(15)13-7)10(16)14-12(11(17)18)5-2-6-12/h3-4H,2,5-6H2,1H3,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | NMZYGEBDUOSATM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |