C24H32FN3O4S — CID 11591048
(4aR)-6-butylsulfonyl-1-(4-fluorophenyl)-4a-(2-methoxyethoxymethyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline (PubChem CID 11591048) has the molecular formula C24H32FN3O4S and a molecular weight of 477.60 g/mol. Its IUPAC name is (4aR)-6-butylsulfonyl-1-(4-fluorophenyl)-4a-(2-methoxyethoxymethyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline.
| Compound Name | (4aR)-6-butylsulfonyl-1-(4-fluorophenyl)-4a-(2-methoxyethoxymethyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline |
|---|---|
| PubChem CID | 11591048 |
| Molecular Formula | C24H32FN3O4S |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | (4aR)-6-butylsulfonyl-1-(4-fluorophenyl)-4a-(2-methoxyethoxymethyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline |
| SMILES | CCCCS(=O)(=O)N1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@]2(COCCOC)C1 |
| InChI | InChI=1S/C24H32FN3O4S/c1-3-4-13-33(29,30)27-10-9-20-14-23-19(15-24(20,17-27)18-32-12-11-31-2)16-26-28(23)22-7-5-21(25)6-8-22/h5-8,14,16H,3-4,9-13,15,17-18H2,1-2H3/t24-/m1/s1 |
| InChIKey | UQFDUMZSEMWVEP-XMMPIXPASA-N |
| XLogP | 3.44 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|