C24H25FN3OS+ — CID 147831002
[(4aR)-1-(4-fluorophenyl)-4a-(methoxymethyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-6-yl]-phenylsulfanium (PubChem CID 147831002) has the molecular formula C24H25FN3OS+ and a molecular weight of 422.55 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-4a-(methoxymethyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-6-yl]-phenylsulfanium.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-4a-(methoxymethyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-6-yl]-phenylsulfanium |
|---|---|
| PubChem CID | 147831002 |
| Molecular Formula | C24H25FN3OS+ |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-4a-(methoxymethyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-6-yl]-phenylsulfanium |
| SMILES | COC[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN([SH+]c1ccccc1)C2 |
| InChI | InChI=1S/C24H24FN3OS/c1-29-17-24-14-18-15-26-28(21-9-7-20(25)8-10-21)23(18)13-19(24)11-12-27(16-24)30-22-5-3-2-4-6-22/h2-10,13,15H,11-12,14,16-17H2,1H3/p+1/t24-/m1/s1 |
| InChIKey | HRCBQKMULAJDKQ-XMMPIXPASA-O |
| XLogP | 4.08 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|