C15H17N3OS — CID 115913584
1-(4-aminophenyl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)cyclopropane-1-carboxamide (PubChem CID 115913584) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 115913584 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-(4-aminophenyl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)cyclopropane-1-carboxamide |
| SMILES | CN(Cc1cscn1)C(=O)C1(c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C15H17N3OS/c1-18(8-13-9-20-10-17-13)14(19)15(6-7-15)11-2-4-12(16)5-3-11/h2-5,9-10H,6-8,16H2,1H3 |
| InChIKey | XLTRMZKKVFUUEY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|