C14H18N4O2 — CID 115915673
2-[[6-(methylamino)-2-phenylpyrimidin-4-yl]amino]propane-1,3-diol (PubChem CID 115915673) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[[6-(methylamino)-2-phenylpyrimidin-4-yl]amino]propane-1,3-diol.
| Compound Name | 2-[[6-(methylamino)-2-phenylpyrimidin-4-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 115915673 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[[6-(methylamino)-2-phenylpyrimidin-4-yl]amino]propane-1,3-diol |
| SMILES | CNc1cc(NC(CO)CO)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H18N4O2/c1-15-12-7-13(16-11(8-19)9-20)18-14(17-12)10-5-3-2-4-6-10/h2-7,11,19-20H,8-9H2,1H3,(H2,15,16,17,18) |
| InChIKey | VKCKDVQHOZOQLX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |