C15H18N4O — CID 115915750
4-N-methyl-4-N-(oxolan-3-yl)-2-phenylpyrimidine-4,6-diamine (PubChem CID 115915750) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-N-methyl-4-N-(oxolan-3-yl)-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-methyl-4-N-(oxolan-3-yl)-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115915750 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-N-methyl-4-N-(oxolan-3-yl)-2-phenylpyrimidine-4,6-diamine |
| SMILES | CN(c1cc(N)nc(-c2ccccc2)n1)C1CCOC1 |
| InChI | InChI=1S/C15H18N4O/c1-19(12-7-8-20-10-12)14-9-13(16)17-15(18-14)11-5-3-2-4-6-11/h2-6,9,12H,7-8,10H2,1H3,(H2,16,17,18) |
| InChIKey | MZMWXVOAJMZEKT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |