C13H20N2 — CID 115916461
N-(1-cyclopropylbutyl)-3-methylpyridin-2-amine (PubChem CID 115916461) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-(1-cyclopropylbutyl)-3-methylpyridin-2-amine.
| Compound Name | N-(1-cyclopropylbutyl)-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 115916461 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-(1-cyclopropylbutyl)-3-methylpyridin-2-amine |
| SMILES | CCCC(Nc1ncccc1C)C1CC1 |
| InChI | InChI=1S/C13H20N2/c1-3-5-12(11-7-8-11)15-13-10(2)6-4-9-14-13/h4,6,9,11-12H,3,5,7-8H2,1-2H3,(H,14,15) |
| InChIKey | URAJHDXCUNBPJY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |