C23H39IO5 — CID 11591722
[(E,3R,4R)-6-iodo-4-methylhex-5-en-3-yl] (2R)-2-[(4S,5R,6S)-2,2,5-trimethyl-6-[(2S,4R)-4-methyl-5-oxopentan-2-yl]-1,3-dioxan-4-yl]propanoate (PubChem CID 11591722) has the molecular formula C23H39IO5 and a molecular weight of 522.46 g/mol. Its IUPAC name is [(E,3R,4R)-6-iodo-4-methylhex-5-en-3-yl] (2R)-2-[(4S,5R,6S)-2,2,5-trimethyl-6-[(2S,4R)-4-methyl-5-oxopentan-2-yl]-1,3-dioxan-4-yl]propanoate.
| Compound Name | [(E,3R,4R)-6-iodo-4-methylhex-5-en-3-yl] (2R)-2-[(4S,5R,6S)-2,2,5-trimethyl-6-[(2S,4R)-4-methyl-5-oxopentan-2-yl]-1,3-dioxan-4-yl]propanoate |
|---|---|
| PubChem CID | 11591722 |
| Molecular Formula | C23H39IO5 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [(E,3R,4R)-6-iodo-4-methylhex-5-en-3-yl] (2R)-2-[(4S,5R,6S)-2,2,5-trimethyl-6-[(2S,4R)-4-methyl-5-oxopentan-2-yl]-1,3-dioxan-4-yl]propanoate |
| SMILES | CC[C@@H](OC(=O)[C@H](C)[C@H]1OC(C)(C)O[C@@H]([C@@H](C)C[C@@H](C)C=O)[C@H]1C)[C@H](C)/C=C/I |
| InChI | InChI=1S/C23H39IO5/c1-9-19(15(3)10-11-24)27-22(26)18(6)21-17(5)20(28-23(7,8)29-21)16(4)12-14(2)13-25/h10-11,13-21H,9,12H2,1-8H3/b11-10+/t14-,15-,16+,17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | FXIUIXAFJBOGLQ-LIFLZVSLSA-N |
| XLogP | 5.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|