C27H46O4 — CID 54361603
3-hexyl-4-[2-[(2R)-oxan-2-yl]oxytrideca-4,7-dienyl]oxetan-2-one (PubChem CID 54361603) has the molecular formula C27H46O4 and a molecular weight of 434.66 g/mol. Its IUPAC name is 3-hexyl-4-[2-[(2R)-oxan-2-yl]oxytrideca-4,7-dienyl]oxetan-2-one.
| Compound Name | 3-hexyl-4-[2-[(2R)-oxan-2-yl]oxytrideca-4,7-dienyl]oxetan-2-one |
|---|---|
| PubChem CID | 54361603 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | 3-hexyl-4-[2-[(2R)-oxan-2-yl]oxytrideca-4,7-dienyl]oxetan-2-one |
| SMILES | CCCCCC=CCC=CCC(CC1OC(=O)C1CCCCCC)O[C@@H]1CCCCO1 |
| InChI | InChI=1S/C27H46O4/c1-3-5-7-9-10-11-12-13-14-18-23(30-26-20-16-17-21-29-26)22-25-24(27(28)31-25)19-15-8-6-4-2/h10-11,13-14,23-26H,3-9,12,15-22H2,1-2H3/t23?,24?,25?,26-/m1/s1 |
| InChIKey | UMWYXSPWJJZXLM-BDSJNSOASA-N |
| XLogP | 7.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|