C27H50O5 — CID 134990750
(Z,5R)-2-hexyl-3-hydroxy-5-(oxan-2-yloxy)hexadec-8-enoic acid (PubChem CID 134990750) has the molecular formula C27H50O5 and a molecular weight of 454.69 g/mol. Its IUPAC name is (Z,5R)-2-hexyl-3-hydroxy-5-(oxan-2-yloxy)hexadec-8-enoic acid.
| Compound Name | (Z,5R)-2-hexyl-3-hydroxy-5-(oxan-2-yloxy)hexadec-8-enoic acid |
|---|---|
| PubChem CID | 134990750 |
| Molecular Formula | C27H50O5 |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.37 |
| IUPAC Name | (Z,5R)-2-hexyl-3-hydroxy-5-(oxan-2-yloxy)hexadec-8-enoic acid |
| SMILES | CCCCCCC/C=C\CC[C@H](CC(O)C(CCCCCC)C(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C27H50O5/c1-3-5-7-9-10-11-12-13-14-18-23(32-26-20-16-17-21-31-26)22-25(28)24(27(29)30)19-15-8-6-4-2/h12-13,23-26,28H,3-11,14-22H2,1-2H3,(H,29,30)/b13-12-/t23-,24?,25?,26?/m1/s1 |
| InChIKey | WHYBJJXWOTZBCX-KAATYXLJSA-N |
| XLogP | 7.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|