C18H32O5 — CID 11267446
tert-butyl (5R,6S)-5-(methoxymethoxy)-6,9-dimethyl-3-oxodec-8-enoate (PubChem CID 11267446) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is tert-butyl (5R,6S)-5-(methoxymethoxy)-6,9-dimethyl-3-oxodec-8-enoate.
| Compound Name | tert-butyl (5R,6S)-5-(methoxymethoxy)-6,9-dimethyl-3-oxodec-8-enoate |
|---|---|
| PubChem CID | 11267446 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl (5R,6S)-5-(methoxymethoxy)-6,9-dimethyl-3-oxodec-8-enoate |
| SMILES | COCO[C@H](CC(=O)CC(=O)OC(C)(C)C)[C@@H](C)CC=C(C)C |
| InChI | InChI=1S/C18H32O5/c1-13(2)8-9-14(3)16(22-12-21-7)10-15(19)11-17(20)23-18(4,5)6/h8,14,16H,9-12H2,1-7H3/t14-,16+/m0/s1 |
| InChIKey | KCSZSQVFSXJPME-GOEBONIOSA-N |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|