C33H58O4 — CID 14852562
3-hexyl-4-[(10Z,13Z)-2-(oxan-2-yloxy)nonadeca-10,13-dienyl]oxetan-2-one (PubChem CID 14852562) has the molecular formula C33H58O4 and a molecular weight of 518.82 g/mol. Its IUPAC name is 3-hexyl-4-[(10Z,13Z)-2-(oxan-2-yloxy)nonadeca-10,13-dienyl]oxetan-2-one.
| Compound Name | 3-hexyl-4-[(10Z,13Z)-2-(oxan-2-yloxy)nonadeca-10,13-dienyl]oxetan-2-one |
|---|---|
| PubChem CID | 14852562 |
| Molecular Formula | C33H58O4 |
| Molecular Weight | 518.82 g/mol |
| Exact Mass | 518.43 |
| IUPAC Name | 3-hexyl-4-[(10Z,13Z)-2-(oxan-2-yloxy)nonadeca-10,13-dienyl]oxetan-2-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CC1OC(=O)C1CCCCCC)OC1CCCCO1 |
| InChI | InChI=1S/C33H58O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-24-29(36-32-26-22-23-27-35-32)28-31-30(33(34)37-31)25-21-8-6-4-2/h10-11,13-14,29-32H,3-9,12,15-28H2,1-2H3/b11-10-,14-13- |
| InChIKey | ZQMKLGAQAJLQEC-XVTLYKPTSA-N |
| XLogP | 9.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.82 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|