C26H26N2O5Se — CID 11591770
(2S)-2-[[4-[methyl(phenylmethoxycarbonyl)amino]benzoyl]amino]-4-phenylselanylbutanoic acid (PubChem CID 11591770) has the molecular formula C26H26N2O5Se and a molecular weight of 525.46 g/mol. Its IUPAC name is (2S)-2-[[4-[methyl(phenylmethoxycarbonyl)amino]benzoyl]amino]-4-phenylselanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[methyl(phenylmethoxycarbonyl)amino]benzoyl]amino]-4-phenylselanylbutanoic acid |
|---|---|
| PubChem CID | 11591770 |
| Molecular Formula | C26H26N2O5Se |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | (2S)-2-[[4-[methyl(phenylmethoxycarbonyl)amino]benzoyl]amino]-4-phenylselanylbutanoic acid |
| SMILES | CN(C(=O)OCc1ccccc1)c1ccc(C(=O)N[C@@H](CC[Se]c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H26N2O5Se/c1-28(26(32)33-18-19-8-4-2-5-9-19)21-14-12-20(13-15-21)24(29)27-23(25(30)31)16-17-34-22-10-6-3-7-11-22/h2-15,23H,16-18H2,1H3,(H,27,29)(H,30,31)/t23-/m0/s1 |
| InChIKey | PIPGPTQCXWGLCH-QHCPKHFHSA-N |
| XLogP | 3.48 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|