C12H17NO2 — CID 115919038
N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine (PubChem CID 115919038) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine.
| Compound Name | N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine |
|---|---|
| PubChem CID | 115919038 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine |
| SMILES | CCC(C)Nc1cccc2c1OCCO2 |
| InChI | InChI=1S/C12H17NO2/c1-3-9(2)13-10-5-4-6-11-12(10)15-8-7-14-11/h4-6,9,13H,3,7-8H2,1-2H3 |
| InChIKey | ZLMQKBKTCXPQBG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |