About N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine
N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine (PubChem CID 115919038) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine |
| PubChem CID | 115919038 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine |
| SMILES | CCC(C)Nc1cccc2c1OCCO2 |
| InChI | InChI=1S/C12H17NO2/c1-3-9(2)13-10-5-4-6-11-12(10)15-8-7-14-11/h4-6,9,13H,3,7-8H2,1-2H3 |
| InChIKey | ZLMQKBKTCXPQBG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine?
The IUPAC name of N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine (CID 115919038) is N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine.
What is the SMILES notation for N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine?
The canonical SMILES for N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine is CCC(C)Nc1cccc2c1OCCO2.
What is the InChIKey of N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine?
The InChIKey is ZLMQKBKTCXPQBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-3-9(2)13-10-5-4-6-11-12(10)15-8-7-14-11/h4-6,9,13H,3,7-8H2,1-2H3.
What are the key properties of N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine?
N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine has a molecular weight of 207.27 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2,3-dihydro-1,4-benzodioxin-5-amine is sourced from PubChem (CID 115919038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).