C12H20ClNOS — CID 115920469
2-[1-(5-chlorothiophen-2-yl)ethylamino]-2-methylpentan-1-ol (PubChem CID 115920469) has the molecular formula C12H20ClNOS and a molecular weight of 261.82 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)ethylamino]-2-methylpentan-1-ol.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)ethylamino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 115920469 |
| Molecular Formula | C12H20ClNOS |
| Molecular Weight | 261.82 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)ethylamino]-2-methylpentan-1-ol |
| SMILES | CCCC(C)(CO)NC(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H20ClNOS/c1-4-7-12(3,8-15)14-9(2)10-5-6-11(13)16-10/h5-6,9,14-15H,4,7-8H2,1-3H3 |
| InChIKey | RGRIEAUYWRRCAD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.82 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |