C10H15F2N3 — CID 115921006
N-(1-cyclopropylethyl)-1-(2,2-difluoroethyl)pyrazol-3-amine (PubChem CID 115921006) has the molecular formula C10H15F2N3 and a molecular weight of 215.25 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-1-(2,2-difluoroethyl)pyrazol-3-amine.
| Compound Name | N-(1-cyclopropylethyl)-1-(2,2-difluoroethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 115921006 |
| Molecular Formula | C10H15F2N3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | N-(1-cyclopropylethyl)-1-(2,2-difluoroethyl)pyrazol-3-amine |
| SMILES | CC(Nc1ccn(CC(F)F)n1)C1CC1 |
| InChI | InChI=1S/C10H15F2N3/c1-7(8-2-3-8)13-10-4-5-15(14-10)6-9(11)12/h4-5,7-9H,2-3,6H2,1H3,(H,13,14) |
| InChIKey | GLPUBSDLSMCNHH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |