C11H19F2N3 — CID 115921014
1-(2,2-difluoroethyl)-N-(4-methylpentan-2-yl)pyrazol-3-amine (PubChem CID 115921014) has the molecular formula C11H19F2N3 and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-(4-methylpentan-2-yl)pyrazol-3-amine.
| Compound Name | 1-(2,2-difluoroethyl)-N-(4-methylpentan-2-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 115921014 |
| Molecular Formula | C11H19F2N3 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-(4-methylpentan-2-yl)pyrazol-3-amine |
| SMILES | CC(C)CC(C)Nc1ccn(CC(F)F)n1 |
| InChI | InChI=1S/C11H19F2N3/c1-8(2)6-9(3)14-11-4-5-16(15-11)7-10(12)13/h4-5,8-10H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | PIBXZCQWODNOCW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |