C11H18N2O2 — CID 115923070
N-(1-ethoxypropan-2-yl)-3-methoxypyridin-2-amine (PubChem CID 115923070) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(1-ethoxypropan-2-yl)-3-methoxypyridin-2-amine.
| Compound Name | N-(1-ethoxypropan-2-yl)-3-methoxypyridin-2-amine |
|---|---|
| PubChem CID | 115923070 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-(1-ethoxypropan-2-yl)-3-methoxypyridin-2-amine |
| SMILES | CCOCC(C)Nc1ncccc1OC |
| InChI | InChI=1S/C11H18N2O2/c1-4-15-8-9(2)13-11-10(14-3)6-5-7-12-11/h5-7,9H,4,8H2,1-3H3,(H,12,13) |
| InChIKey | YCCDFKMOUMTEDO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |