C12H19FN2O — CID 103270021
N-(1-ethoxy-3-methylbutan-2-yl)-3-fluoropyridin-2-amine (PubChem CID 103270021) has the molecular formula C12H19FN2O and a molecular weight of 226.29 g/mol. Its IUPAC name is N-(1-ethoxy-3-methylbutan-2-yl)-3-fluoropyridin-2-amine.
| Compound Name | N-(1-ethoxy-3-methylbutan-2-yl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 103270021 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-(1-ethoxy-3-methylbutan-2-yl)-3-fluoropyridin-2-amine |
| SMILES | CCOCC(Nc1ncccc1F)C(C)C |
| InChI | InChI=1S/C12H19FN2O/c1-4-16-8-11(9(2)3)15-12-10(13)6-5-7-14-12/h5-7,9,11H,4,8H2,1-3H3,(H,14,15) |
| InChIKey | DSTWBCQYWWYTBL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |