C13H21FN2 — CID 62732858
3-fluoro-N-(6-methylheptan-2-yl)pyridin-2-amine (PubChem CID 62732858) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 3-fluoro-N-(6-methylheptan-2-yl)pyridin-2-amine.
| Compound Name | 3-fluoro-N-(6-methylheptan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 62732858 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 3-fluoro-N-(6-methylheptan-2-yl)pyridin-2-amine |
| SMILES | CC(C)CCCC(C)Nc1ncccc1F |
| InChI | InChI=1S/C13H21FN2/c1-10(2)6-4-7-11(3)16-13-12(14)8-5-9-15-13/h5,8-11H,4,6-7H2,1-3H3,(H,15,16) |
| InChIKey | HUCDXZYSRYGSTL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |