C13H19F3N2 — CID 63541338
N-heptan-2-yl-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 63541338) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N-heptan-2-yl-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-heptan-2-yl-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63541338 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-heptan-2-yl-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCCCC(C)Nc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-3-4-5-7-10(2)18-12-11(13(14,15)16)8-6-9-17-12/h6,8-10H,3-5,7H2,1-2H3,(H,17,18) |
| InChIKey | ZQJMMFGEEKFKND-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|