C11H9N3S2 — CID 115924581
N-(1-benzothiophen-2-ylmethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 115924581) has the molecular formula C11H9N3S2 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-(1-benzothiophen-2-ylmethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(1-benzothiophen-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 115924581 |
| Molecular Formula | C11H9N3S2 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | N-(1-benzothiophen-2-ylmethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc2sc(CNc3nncs3)cc2c1 |
| InChI | InChI=1S/C11H9N3S2/c1-2-4-10-8(3-1)5-9(16-10)6-12-11-14-13-7-15-11/h1-5,7H,6H2,(H,12,14) |
| InChIKey | ICDMDWVJQCFYKI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |