C10H10ClN3S — CID 107233099
N-[[4-(chloromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 107233099) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is N-[[4-(chloromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[[4-(chloromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107233099 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | N-[[4-(chloromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | ClCc1ccc(CNc2nncs2)cc1 |
| InChI | InChI=1S/C10H10ClN3S/c11-5-8-1-3-9(4-2-8)6-12-10-14-13-7-15-10/h1-4,7H,5-6H2,(H,12,14) |
| InChIKey | IQGPCBRAKXNNPT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|