C7H7N5S — CID 82669856
N-(pyrimidin-5-ylmethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 82669856) has the molecular formula C7H7N5S and a molecular weight of 193.24 g/mol. Its IUPAC name is N-(pyrimidin-5-ylmethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(pyrimidin-5-ylmethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82669856 |
| Molecular Formula | C7H7N5S |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | N-(pyrimidin-5-ylmethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1ncc(CNc2nncs2)cn1 |
| InChI | InChI=1S/C7H7N5S/c1-6(2-9-4-8-1)3-10-7-12-11-5-13-7/h1-2,4-5H,3H2,(H,10,12) |
| InChIKey | ANYJONYRQWTTBY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |