C12H11N5S — CID 103746202
N-[(1-phenylpyrazol-4-yl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 103746202) has the molecular formula C12H11N5S and a molecular weight of 257.32 g/mol. Its IUPAC name is N-[(1-phenylpyrazol-4-yl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(1-phenylpyrazol-4-yl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 103746202 |
| Molecular Formula | C12H11N5S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-[(1-phenylpyrazol-4-yl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc(-n2cc(CNc3nncs3)cn2)cc1 |
| InChI | InChI=1S/C12H11N5S/c1-2-4-11(5-3-1)17-8-10(7-15-17)6-13-12-16-14-9-18-12/h1-5,7-9H,6H2,(H,13,16) |
| InChIKey | PWHQIMPNAATYFX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |